C14H19FN2O2S — CID 68691572
N-cyclopropyl-4-fluoro-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 68691572) has the molecular formula C14H19FN2O2S and a molecular weight of 298.38 g/mol. Its IUPAC name is N-cyclopropyl-4-fluoro-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | N-cyclopropyl-4-fluoro-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 68691572 |
| Molecular Formula | C14H19FN2O2S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N-cyclopropyl-4-fluoro-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(F)cc1)N(C1CCNCC1)C1CC1 |
| InChI | InChI=1S/C14H19FN2O2S/c15-11-1-5-14(6-2-11)20(18,19)17(12-3-4-12)13-7-9-16-10-8-13/h1-2,5-6,12-13,16H,3-4,7-10H2 |
| InChIKey | ZMLNMGBYNNDGMZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |