C14H24ClN3O2S — CID 120875073
4-[(dimethylamino)methyl]-N-methyl-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride (PubChem CID 120875073) has the molecular formula C14H24ClN3O2S and a molecular weight of 333.89 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-N-methyl-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-[(dimethylamino)methyl]-N-methyl-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120875073 |
| Molecular Formula | C14H24ClN3O2S |
| Molecular Weight | 333.89 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-[(dimethylamino)methyl]-N-methyl-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride |
| SMILES | CN(C)Cc1ccc(S(=O)(=O)N(C)C2CCNC2)cc1.Cl |
| InChI | InChI=1S/C14H23N3O2S.ClH/c1-16(2)11-12-4-6-14(7-5-12)20(18,19)17(3)13-8-9-15-10-13;/h4-7,13,15H,8-11H2,1-3H3;1H |
| InChIKey | XUZUPDCCIOWIQR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.89 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |