C10H15ClN2O2S2 — CID 55206101
5-chloro-N-ethyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide (PubChem CID 55206101) has the molecular formula C10H15ClN2O2S2 and a molecular weight of 294.83 g/mol. Its IUPAC name is 5-chloro-N-ethyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-ethyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55206101 |
| Molecular Formula | C10H15ClN2O2S2 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 5-chloro-N-ethyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide |
| SMILES | CCN(C1CCNC1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H15ClN2O2S2/c1-2-13(8-5-6-12-7-8)17(14,15)10-4-3-9(11)16-10/h3-4,8,12H,2,5-7H2,1H3 |
| InChIKey | PXHPWELRSIJWKC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |