C14H19ClN4O2S — CID 119979118
N-methyl-1-phenyl-N-pyrrolidin-3-ylpyrazole-4-sulfonamide;hydrochloride (PubChem CID 119979118) has the molecular formula C14H19ClN4O2S and a molecular weight of 342.85 g/mol. Its IUPAC name is N-methyl-1-phenyl-N-pyrrolidin-3-ylpyrazole-4-sulfonamide;hydrochloride.
| Compound Name | N-methyl-1-phenyl-N-pyrrolidin-3-ylpyrazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119979118 |
| Molecular Formula | C14H19ClN4O2S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-methyl-1-phenyl-N-pyrrolidin-3-ylpyrazole-4-sulfonamide;hydrochloride |
| SMILES | CN(C1CCNC1)S(=O)(=O)c1cnn(-c2ccccc2)c1.Cl |
| InChI | InChI=1S/C14H18N4O2S.ClH/c1-17(13-7-8-15-9-13)21(19,20)14-10-16-18(11-14)12-5-3-2-4-6-12;/h2-6,10-11,13,15H,7-9H2,1H3;1H |
| InChIKey | YDICMTVIXBKWFT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |