C13H20ClN3O5S — CID 119980430
1-(2-methoxy-4-nitrophenyl)sulfonyl-3,5-dimethylpiperazine;hydrochloride (PubChem CID 119980430) has the molecular formula C13H20ClN3O5S and a molecular weight of 365.84 g/mol. Its IUPAC name is 1-(2-methoxy-4-nitrophenyl)sulfonyl-3,5-dimethylpiperazine;hydrochloride.
| Compound Name | 1-(2-methoxy-4-nitrophenyl)sulfonyl-3,5-dimethylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 119980430 |
| Molecular Formula | C13H20ClN3O5S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1-(2-methoxy-4-nitrophenyl)sulfonyl-3,5-dimethylpiperazine;hydrochloride |
| SMILES | COc1cc([N+](=O)[O-])ccc1S(=O)(=O)N1CC(C)NC(C)C1.Cl |
| InChI | InChI=1S/C13H19N3O5S.ClH/c1-9-7-15(8-10(2)14-9)22(19,20)13-5-4-11(16(17)18)6-12(13)21-3;/h4-6,9-10,14H,7-8H2,1-3H3;1H |
| InChIKey | DJFUUABVXKASII-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|