C13H20ClN3O5S — CID 120582087
[1-(2-methoxy-4-nitrophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120582087) has the molecular formula C13H20ClN3O5S and a molecular weight of 365.84 g/mol. Its IUPAC name is [1-(2-methoxy-4-nitrophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(2-methoxy-4-nitrophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120582087 |
| Molecular Formula | C13H20ClN3O5S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | [1-(2-methoxy-4-nitrophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | COc1cc([N+](=O)[O-])ccc1S(=O)(=O)N1CC(CN)CC1C.Cl |
| InChI | InChI=1S/C13H19N3O5S.ClH/c1-9-5-10(7-14)8-15(9)22(19,20)13-4-3-11(16(17)18)6-12(13)21-2;/h3-4,6,9-10H,5,7-8,14H2,1-2H3;1H |
| InChIKey | XRWNZBVFMNLUMD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|