C14H19N3O2S — CID 119982695
N-(1-aminopropan-2-yl)-N,3-dimethylquinoline-8-sulfonamide (PubChem CID 119982695) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N,3-dimethylquinoline-8-sulfonamide.
| Compound Name | N-(1-aminopropan-2-yl)-N,3-dimethylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 119982695 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N,3-dimethylquinoline-8-sulfonamide |
| SMILES | Cc1cnc2c(S(=O)(=O)N(C)C(C)CN)cccc2c1 |
| InChI | InChI=1S/C14H19N3O2S/c1-10-7-12-5-4-6-13(14(12)16-9-10)20(18,19)17(3)11(2)8-15/h4-7,9,11H,8,15H2,1-3H3 |
| InChIKey | AMWZFAAMBFFPOH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |