C15H20ClN3O2S — CID 119986825
N-(2-amino-1-cyclopropylethyl)-3-methylquinoline-8-sulfonamide;hydrochloride (PubChem CID 119986825) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-3-methylquinoline-8-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-3-methylquinoline-8-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119986825 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-3-methylquinoline-8-sulfonamide;hydrochloride |
| SMILES | Cc1cnc2c(S(=O)(=O)NC(CN)C3CC3)cccc2c1.Cl |
| InChI | InChI=1S/C15H19N3O2S.ClH/c1-10-7-12-3-2-4-14(15(12)17-9-10)21(19,20)18-13(8-16)11-5-6-11;/h2-4,7,9,11,13,18H,5-6,8,16H2,1H3;1H |
| InChIKey | QQBWLQLMBXXVSA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |