C16H23N3O2S — CID 119983405
N-(1-amino-4-methylpentan-2-yl)-1-quinolin-8-ylmethanesulfonamide (PubChem CID 119983405) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-1-quinolin-8-ylmethanesulfonamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-1-quinolin-8-ylmethanesulfonamide |
|---|---|
| PubChem CID | 119983405 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-1-quinolin-8-ylmethanesulfonamide |
| SMILES | CC(C)CC(CN)NS(=O)(=O)Cc1cccc2cccnc12 |
| InChI | InChI=1S/C16H23N3O2S/c1-12(2)9-15(10-17)19-22(20,21)11-14-6-3-5-13-7-4-8-18-16(13)14/h3-8,12,15,19H,9-11,17H2,1-2H3 |
| InChIKey | XRZFTQZXIKOXOO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |