C14H14N2O3S — CID 155945521
N-(quinolin-8-ylmethylsulfonyl)cyclopropanecarboxamide (PubChem CID 155945521) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-(quinolin-8-ylmethylsulfonyl)cyclopropanecarboxamide.
| Compound Name | N-(quinolin-8-ylmethylsulfonyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 155945521 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-(quinolin-8-ylmethylsulfonyl)cyclopropanecarboxamide |
| SMILES | O=C(NS(=O)(=O)Cc1cccc2cccnc12)C1CC1 |
| InChI | InChI=1S/C14H14N2O3S/c17-14(11-6-7-11)16-20(18,19)9-12-4-1-3-10-5-2-8-15-13(10)12/h1-5,8,11H,6-7,9H2,(H,16,17) |
| InChIKey | JZXVIJZDIFYJOZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |