C14H22N2O5S — CID 119984436
ethyl 5-[3-(1-aminoethyl)piperidin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 119984436) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is ethyl 5-[3-(1-aminoethyl)piperidin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[3-(1-aminoethyl)piperidin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 119984436 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | ethyl 5-[3-(1-aminoethyl)piperidin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCCC(C(C)N)C2)o1 |
| InChI | InChI=1S/C14H22N2O5S/c1-3-20-14(17)12-6-7-13(21-12)22(18,19)16-8-4-5-11(9-16)10(2)15/h6-7,10-11H,3-5,8-9,15H2,1-2H3 |
| InChIKey | CRIMMGGGVOOVLN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |