C15H21ClN4O2S — CID 119991320
N-methyl-1-[1-(1-phenylpyrazol-4-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 119991320) has the molecular formula C15H21ClN4O2S and a molecular weight of 356.88 g/mol. Its IUPAC name is N-methyl-1-[1-(1-phenylpyrazol-4-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | N-methyl-1-[1-(1-phenylpyrazol-4-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119991320 |
| Molecular Formula | C15H21ClN4O2S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-methyl-1-[1-(1-phenylpyrazol-4-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | CNCC1CCCN1S(=O)(=O)c1cnn(-c2ccccc2)c1.Cl |
| InChI | InChI=1S/C15H20N4O2S.ClH/c1-16-10-14-8-5-9-19(14)22(20,21)15-11-17-18(12-15)13-6-3-2-4-7-13;/h2-4,6-7,11-12,14,16H,5,8-10H2,1H3;1H |
| InChIKey | JUQBRUODALNSBU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |