C16H28N2O4S — CID 119991812
N-(3-amino-2,2-dimethylpropyl)-4-(2-ethoxyethoxy)-N-methylbenzenesulfonamide (PubChem CID 119991812) has the molecular formula C16H28N2O4S and a molecular weight of 344.48 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-4-(2-ethoxyethoxy)-N-methylbenzenesulfonamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-4-(2-ethoxyethoxy)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 119991812 |
| Molecular Formula | C16H28N2O4S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-4-(2-ethoxyethoxy)-N-methylbenzenesulfonamide |
| SMILES | CCOCCOc1ccc(S(=O)(=O)N(C)CC(C)(C)CN)cc1 |
| InChI | InChI=1S/C16H28N2O4S/c1-5-21-10-11-22-14-6-8-15(9-7-14)23(19,20)18(4)13-16(2,3)12-17/h6-9H,5,10-13,17H2,1-4H3 |
| InChIKey | LIHCCRSIGBSGPK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|