C19H29N3O4S — CID 119992800
1-[5-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-2-methyl-2,3-dihydroindol-1-yl]ethanone (PubChem CID 119992800) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[5-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-2-methyl-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-2-methyl-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 119992800 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-[5-[4-(3-aminopropoxy)piperidin-1-yl]sulfonyl-2-methyl-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(S(=O)(=O)N3CCC(OCCCN)CC3)cc2CC1C |
| InChI | InChI=1S/C19H29N3O4S/c1-14-12-16-13-18(4-5-19(16)22(14)15(2)23)27(24,25)21-9-6-17(7-10-21)26-11-3-8-20/h4-5,13-14,17H,3,6-12,20H2,1-2H3 |
| InChIKey | ZJRIMBNUCSTTQI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|