C16H23FN4O2S — CID 119993085
N-(1-aminohexan-2-yl)-3-fluoro-4-(4-methylpyrazol-1-yl)benzenesulfonamide (PubChem CID 119993085) has the molecular formula C16H23FN4O2S and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-fluoro-4-(4-methylpyrazol-1-yl)benzenesulfonamide.
| Compound Name | N-(1-aminohexan-2-yl)-3-fluoro-4-(4-methylpyrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 119993085 |
| Molecular Formula | C16H23FN4O2S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-fluoro-4-(4-methylpyrazol-1-yl)benzenesulfonamide |
| SMILES | CCCCC(CN)NS(=O)(=O)c1ccc(-n2cc(C)cn2)c(F)c1 |
| InChI | InChI=1S/C16H23FN4O2S/c1-3-4-5-13(9-18)20-24(22,23)14-6-7-16(15(17)8-14)21-11-12(2)10-19-21/h6-8,10-11,13,20H,3-5,9,18H2,1-2H3 |
| InChIKey | MJVZKVJGUVTMSE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |