About 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid
2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid (PubChem CID 119994967) has the molecular formula C19H19NO5
and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid |
| PubChem CID | 119994967 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid |
| SMILES | Cc1cc(OCC(=O)O)ccc1NC(=O)C1OCCc2ccccc21 |
| InChI | InChI=1S/C19H19NO5/c1-12-10-14(25-11-17(21)22)6-7-16(12)20-19(23)18-15-5-3-2-4-13(15)8-9-24-18/h2-7,10,18H,8-9,11H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | PJRPYYATTHMGIM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid?
The IUPAC name of 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid (CID 119994967) is 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid.
What is the SMILES notation for 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid?
The canonical SMILES for 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid is Cc1cc(OCC(=O)O)ccc1NC(=O)C1OCCc2ccccc21.
What is the InChIKey of 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid?
The InChIKey is PJRPYYATTHMGIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO5/c1-12-10-14(25-11-17(21)22)6-7-16(12)20-19(23)18-15-5-3-2-4-13(15)8-9-24-18/h2-7,10,18H,8-9,11H2,1H3,(H,20,23)(H,21,22).
What are the key properties of 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid?
2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid has a molecular weight of 341.36 g/mol, XLogP of 2.71, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dihydro-1H-isochromene-1-carbonylamino)-3-methylphenoxy]acetic acid is sourced from PubChem (CID 119994967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).