C13H20ClN3OS — CID 119999169
6-amino-N-(3-methylsulfanylcyclohexyl)pyridine-2-carboxamide;hydrochloride (PubChem CID 119999169) has the molecular formula C13H20ClN3OS and a molecular weight of 301.84 g/mol. Its IUPAC name is 6-amino-N-(3-methylsulfanylcyclohexyl)pyridine-2-carboxamide;hydrochloride.
| Compound Name | 6-amino-N-(3-methylsulfanylcyclohexyl)pyridine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119999169 |
| Molecular Formula | C13H20ClN3OS |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 6-amino-N-(3-methylsulfanylcyclohexyl)pyridine-2-carboxamide;hydrochloride |
| SMILES | CSC1CCCC(NC(=O)c2cccc(N)n2)C1.Cl |
| InChI | InChI=1S/C13H19N3OS.ClH/c1-18-10-5-2-4-9(8-10)15-13(17)11-6-3-7-12(14)16-11;/h3,6-7,9-10H,2,4-5,8H2,1H3,(H2,14,16)(H,15,17);1H |
| InChIKey | RDAFHLVJGOLSDX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |