C15H26N6O2 — CID 119999867
methyl 2-[4-[[[C-(3,5-dimethylpiperidin-1-yl)-N-methylcarbonimidoyl]amino]methyl]triazol-1-yl]acetate (PubChem CID 119999867) has the molecular formula C15H26N6O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is methyl 2-[4-[[[C-(3,5-dimethylpiperidin-1-yl)-N-methylcarbonimidoyl]amino]methyl]triazol-1-yl]acetate.
| Compound Name | methyl 2-[4-[[[C-(3,5-dimethylpiperidin-1-yl)-N-methylcarbonimidoyl]amino]methyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 119999867 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | methyl 2-[4-[[[C-(3,5-dimethylpiperidin-1-yl)-N-methylcarbonimidoyl]amino]methyl]triazol-1-yl]acetate |
| SMILES | C/N=C(\NCc1cn(CC(=O)OC)nn1)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C15H26N6O2/c1-11-5-12(2)8-20(7-11)15(16-3)17-6-13-9-21(19-18-13)10-14(22)23-4/h9,11-12H,5-8,10H2,1-4H3,(H,16,17) |
| InChIKey | TVYOGANJNRNHKV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|