C27H22N3O2PS — CID 12000047
ethyl 7-[(triphenyl-λ5-phosphanylidene)amino]thieno[2,3-b]pyrazine-6-carboxylate (PubChem CID 12000047) has the molecular formula C27H22N3O2PS and a molecular weight of 483.53 g/mol. Its IUPAC name is ethyl 7-[(triphenyl-λ5-phosphanylidene)amino]thieno[2,3-b]pyrazine-6-carboxylate.
| Compound Name | ethyl 7-[(triphenyl-λ5-phosphanylidene)amino]thieno[2,3-b]pyrazine-6-carboxylate |
|---|---|
| PubChem CID | 12000047 |
| Molecular Formula | C27H22N3O2PS |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | ethyl 7-[(triphenyl-λ5-phosphanylidene)amino]thieno[2,3-b]pyrazine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nccnc2c1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22N3O2PS/c1-2-32-27(31)25-23(24-26(34-25)29-19-18-28-24)30-33(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-19H,2H2,1H3 |
| InChIKey | VWXPBSOSWKUKCN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|