C10H15IO3 — CID 12000317
(3aR,4R,5S,7aR)-4-iodo-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-ol (PubChem CID 12000317) has the molecular formula C10H15IO3 and a molecular weight of 310.13 g/mol. Its IUPAC name is (3aR,4R,5S,7aR)-4-iodo-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-ol.
| Compound Name | (3aR,4R,5S,7aR)-4-iodo-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 12000317 |
| Molecular Formula | C10H15IO3 |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | (3aR,4R,5S,7aR)-4-iodo-2,2,7-trimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-ol |
| SMILES | CC1=C[C@H](O)[C@@H](I)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C10H15IO3/c1-5-4-6(12)7(11)9-8(5)13-10(2,3)14-9/h4,6-9,12H,1-3H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | OYUKUHSLEQZXPH-KDXUFGMBSA-N |
| XLogP | 1.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|