C35H37Cl3F3N3O4 — CID 12001869
(3R,4S)-N-[[2-chloro-5-[(3,3,3-trifluoropropanoylamino)methyl]phenyl]methyl]-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxamide (PubChem CID 12001869) has the molecular formula C35H37Cl3F3N3O4 and a molecular weight of 727.05 g/mol. Its IUPAC name is (3R,4S)-N-[[2-chloro-5-[(3,3,3-trifluoropropanoylamino)methyl]phenyl]methyl]-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-[[2-chloro-5-[(3,3,3-trifluoropropanoylamino)methyl]phenyl]methyl]-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 12001869 |
| Molecular Formula | C35H37Cl3F3N3O4 |
| Molecular Weight | 727.05 g/mol |
| Exact Mass | 725.18 |
| IUPAC Name | (3R,4S)-N-[[2-chloro-5-[(3,3,3-trifluoropropanoylamino)methyl]phenyl]methyl]-N-cyclopropyl-4-[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(Cl)c(OCCOc2ccc([C@H]3CCNC[C@@H]3C(=O)N(Cc3cc(CNC(=O)CC(F)(F)F)ccc3Cl)C3CC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C35H37Cl3F3N3O4/c1-21-14-30(37)33(31(38)15-21)48-13-12-47-26-7-3-23(4-8-26)27-10-11-42-19-28(27)34(46)44(25-5-6-25)20-24-16-22(2-9-29(24)36)18-43-32(45)17-35(39,40)41/h2-4,7-9,14-16,25,27-28,42H,5-6,10-13,17-20H2,1H3,(H,43,45)/t27-,28+/m1/s1 |
| InChIKey | GEBGDXKEDPYHHN-IZLXSDGUSA-N |
| XLogP | 7.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.05 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|