C24H21ClN2O6S2 — CID 12002431
2-[(5E)-5-[[3-chloro-4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 12002431) has the molecular formula C24H21ClN2O6S2 and a molecular weight of 533.03 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-chloro-4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[3-chloro-4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 12002431 |
| Molecular Formula | C24H21ClN2O6S2 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | 2-[(5E)-5-[[3-chloro-4-[4-[(3-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl]phenoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCN1C(=O)OCC1Cc1ccc(Oc2ccc(/C=C3/SC(=S)N(CC(=O)O)C3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C24H21ClN2O6S2/c1-2-26-16(13-32-23(26)31)9-14-3-6-17(7-4-14)33-19-8-5-15(10-18(19)25)11-20-22(30)27(12-21(28)29)24(34)35-20/h3-8,10-11,16H,2,9,12-13H2,1H3,(H,28,29)/b20-11+ |
| InChIKey | BPLAKJGCOFGRAS-RGVLZGJSSA-N |
| XLogP | 4.80 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|