C17H22O3 — CID 12003259
(2R,4R,6S)-6-ethenyl-4,6-diethyl-2-phenyl-1,3-dioxane-4-carbaldehyde (PubChem CID 12003259) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2R,4R,6S)-6-ethenyl-4,6-diethyl-2-phenyl-1,3-dioxane-4-carbaldehyde.
| Compound Name | (2R,4R,6S)-6-ethenyl-4,6-diethyl-2-phenyl-1,3-dioxane-4-carbaldehyde |
|---|---|
| PubChem CID | 12003259 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2R,4R,6S)-6-ethenyl-4,6-diethyl-2-phenyl-1,3-dioxane-4-carbaldehyde |
| SMILES | C=C[C@]1(CC)C[C@@](C=O)(CC)O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C17H22O3/c1-4-16(5-2)12-17(6-3,13-18)20-15(19-16)14-10-8-7-9-11-14/h4,7-11,13,15H,1,5-6,12H2,2-3H3/t15-,16+,17-/m1/s1 |
| InChIKey | KWUJLRLXNPDEJE-IXDOHACOSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|