C20H22N4OS — CID 12005094
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2,6-dimethylphenyl)thiourea (PubChem CID 12005094) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2,6-dimethylphenyl)thiourea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2,6-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 12005094 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2,6-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)Nc1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H22N4OS/c1-13-9-8-10-14(2)17(13)21-20(26)22-18-15(3)23(4)24(19(18)25)16-11-6-5-7-12-16/h5-12H,1-4H3,(H2,21,22,26) |
| InChIKey | HEUIFFFEXBRANX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|