C14H20ClN3O3S — CID 12005593
2-[(4-butoxy-3-nitrophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride (PubChem CID 12005593) has the molecular formula C14H20ClN3O3S and a molecular weight of 345.85 g/mol. Its IUPAC name is 2-[(4-butoxy-3-nitrophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride.
| Compound Name | 2-[(4-butoxy-3-nitrophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride |
|---|---|
| PubChem CID | 12005593 |
| Molecular Formula | C14H20ClN3O3S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[(4-butoxy-3-nitrophenyl)methylsulfanyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| SMILES | CCCCOc1ccc(CSC2=NCCN2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H19N3O3S.ClH/c1-2-3-8-20-13-5-4-11(9-12(13)17(18)19)10-21-14-15-6-7-16-14;/h4-5,9H,2-3,6-8,10H2,1H3,(H,15,16);1H |
| InChIKey | AZCAPEFJUXQTBA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|