About 1-(isocyanomethyl)pyrene
1-(isocyanomethyl)pyrene (PubChem CID 12006963) has the molecular formula C18H11N
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-(isocyanomethyl)pyrene.
Molecular Properties
| Compound Name | 1-(isocyanomethyl)pyrene |
| PubChem CID | 12006963 |
| Molecular Formula | C18H11N |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(isocyanomethyl)pyrene |
| SMILES | [C-]#[N+]Cc1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C18H11N/c1-19-11-15-8-7-14-6-5-12-3-2-4-13-9-10-16(15)18(14)17(12)13/h2-10H,11H2 |
| InChIKey | XFFUEZUYYLAXKT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(isocyanomethyl)pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(isocyanomethyl)pyrene?
The IUPAC name of 1-(isocyanomethyl)pyrene (CID 12006963) is 1-(isocyanomethyl)pyrene.
What is the SMILES notation for 1-(isocyanomethyl)pyrene?
The canonical SMILES for 1-(isocyanomethyl)pyrene is [C-]#[N+]Cc1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of 1-(isocyanomethyl)pyrene?
The InChIKey is XFFUEZUYYLAXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11N/c1-19-11-15-8-7-14-6-5-12-3-2-4-13-9-10-16(15)18(14)17(12)13/h2-10H,11H2.
What are the key properties of 1-(isocyanomethyl)pyrene?
1-(isocyanomethyl)pyrene has a molecular weight of 241.29 g/mol, XLogP of 5.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(isocyanomethyl)pyrene is sourced from PubChem (CID 12006963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).