C39H46O8S2 — CID 12009919
ethyl [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanesulfonate (PubChem CID 12009919) has the molecular formula C39H46O8S2 and a molecular weight of 706.92 g/mol. Its IUPAC name is ethyl [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanesulfonate.
| Compound Name | ethyl [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 12009919 |
| Molecular Formula | C39H46O8S2 |
| Molecular Weight | 706.92 g/mol |
| Exact Mass | 706.26 |
| IUPAC Name | ethyl [(2S,3R,4S,5R,6R)-2-ethylsulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methanesulfonate |
| SMILES | CCOS(=O)(=O)C[C@]1(SCC)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H46O8S2/c1-3-46-49(40,41)30-39(48-4-2)38(45-28-34-23-15-8-16-24-34)37(44-27-33-21-13-7-14-22-33)36(43-26-32-19-11-6-12-20-32)35(47-39)29-42-25-31-17-9-5-10-18-31/h5-24,35-38H,3-4,25-30H2,1-2H3/t35-,36-,37+,38-,39-/m1/s1 |
| InChIKey | JWKRTVBDLFNALX-GFRPZHATSA-N |
| XLogP | 7.17 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.92 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|