C18H25NO5 — CID 12012077
4-[(4aR,6S,7R,8aS)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]morpholine (PubChem CID 12012077) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-[(4aR,6S,7R,8aS)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]morpholine.
| Compound Name | 4-[(4aR,6S,7R,8aS)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]morpholine |
|---|---|
| PubChem CID | 12012077 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-[(4aR,6S,7R,8aS)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]morpholine |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2C[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C18H25NO5/c1-20-18-14(19-7-9-21-10-8-19)11-15-16(24-18)12-22-17(23-15)13-5-3-2-4-6-13/h2-6,14-18H,7-12H2,1H3/t14-,15+,16-,17?,18+/m1/s1 |
| InChIKey | IHGJTCSKMQPGNI-JILJLDPQSA-N |
| XLogP | 1.56 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |