C21H22O5S — CID 22802290
O-[(4aR,6S,7R,8aS)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzenecarbothioate (PubChem CID 22802290) has the molecular formula C21H22O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is O-[(4aR,6S,7R,8aS)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzenecarbothioate.
| Compound Name | O-[(4aR,6S,7R,8aS)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzenecarbothioate |
|---|---|
| PubChem CID | 22802290 |
| Molecular Formula | C21H22O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | O-[(4aR,6S,7R,8aS)-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzenecarbothioate |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2C[C@H]1OC(=S)c1ccccc1 |
| InChI | InChI=1S/C21H22O5S/c1-22-20-17(26-21(27)15-10-6-3-7-11-15)12-16-18(25-20)13-23-19(24-16)14-8-4-2-5-9-14/h2-11,16-20H,12-13H2,1H3/t16-,17+,18+,19?,20-/m0/s1 |
| InChIKey | AOBKUSVZIGXFKO-APYTWINISA-N |
| XLogP | 3.62 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|