C18H19NO4 — CID 12012187
dimethyl (2S,4S,5R)-5-naphthalen-2-ylpyrrolidine-2,4-dicarboxylate (PubChem CID 12012187) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is dimethyl (2S,4S,5R)-5-naphthalen-2-ylpyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2S,4S,5R)-5-naphthalen-2-ylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 12012187 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | dimethyl (2S,4S,5R)-5-naphthalen-2-ylpyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](C(=O)OC)[C@H](c2ccc3ccccc3c2)N1 |
| InChI | InChI=1S/C18H19NO4/c1-22-17(20)14-10-15(18(21)23-2)19-16(14)13-8-7-11-5-3-4-6-12(11)9-13/h3-9,14-16,19H,10H2,1-2H3/t14-,15-,16-/m0/s1 |
| InChIKey | JPZNQSAKTFJMRE-JYJNAYRXSA-N |
| XLogP | 2.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |