C18H20F3NO6 — CID 135006217
2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3,4-tricarboxylate (PubChem CID 135006217) has the molecular formula C18H20F3NO6 and a molecular weight of 403.35 g/mol. Its IUPAC name is 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3,4-tricarboxylate.
| Compound Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 135006217 |
| Molecular Formula | C18H20F3NO6 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-O-ethyl 3-O,4-O-dimethyl (2R,3S,4R,5S)-5-[4-(trifluoromethyl)phenyl]pyrrolidine-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)[C@@H]1N[C@H](c2ccc(C(F)(F)F)cc2)[C@H](C(=O)OC)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C18H20F3NO6/c1-4-28-17(25)14-12(16(24)27-3)11(15(23)26-2)13(22-14)9-5-7-10(8-6-9)18(19,20)21/h5-8,11-14,22H,4H2,1-3H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | VGYADSSCNGVHOY-XJFOESAGSA-N |
| XLogP | 1.86 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|