About 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide
5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide (PubChem CID 12012419) has the molecular formula C18H17F3IN3
and a molecular weight of 459.25 g/mol. Its IUPAC name is 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide.
Molecular Properties
| Compound Name | 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide |
| PubChem CID | 12012419 |
| Molecular Formula | C18H17F3IN3 |
| Molecular Weight | 459.25 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide |
| SMILES | CCCN1CC[n+]2c(-c3ccccc3)cc(C(F)(F)F)c(C#N)c21.[I-] |
| InChI | InChI=1S/C18H17F3N3.HI/c1-2-8-23-9-10-24-16(13-6-4-3-5-7-13)11-15(18(19,20)21)14(12-22)17(23)24;/h3-7,11H,2,8-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | FUHYGZUQEOSFGD-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 30.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide?
The IUPAC name of 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide (CID 12012419) is 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide.
What is the SMILES notation for 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide?
The canonical SMILES for 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide is CCCN1CC[n+]2c(-c3ccccc3)cc(C(F)(F)F)c(C#N)c21.[I-].
What is the InChIKey of 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide?
The InChIKey is FUHYGZUQEOSFGD-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H17F3N3.HI/c1-2-8-23-9-10-24-16(13-6-4-3-5-7-13)11-15(18(19,20)21)14(12-22)17(23)24;/h3-7,11H,2,8-10H2,1H3;1H/q+1;/p-1.
What are the key properties of 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide?
5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide has a molecular weight of 459.25 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide is sourced from PubChem (CID 12012419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).