C18H17F3IN3 — CID 12012419
5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide (PubChem CID 12012419) has the molecular formula C18H17F3IN3 and a molecular weight of 459.25 g/mol. Its IUPAC name is 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide.
| Compound Name | 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide |
|---|---|
| PubChem CID | 12012419 |
| Molecular Formula | C18H17F3IN3 |
| Molecular Weight | 459.25 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 5-phenyl-1-propyl-7-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-8-carbonitrile iodide |
| SMILES | CCCN1CC[n+]2c(-c3ccccc3)cc(C(F)(F)F)c(C#N)c21.[I-] |
| InChI | InChI=1S/C18H17F3N3.HI/c1-2-8-23-9-10-24-16(13-6-4-3-5-7-13)11-15(18(19,20)21)14(12-22)17(23)24;/h3-7,11H,2,8-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | FUHYGZUQEOSFGD-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 30.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|