C19H25ClN2O2S — CID 12013366
4-[(4-chlorophenyl)methyl]-N-cyclohexyl-3-methyl-5-oxothiomorpholine-3-carboxamide (PubChem CID 12013366) has the molecular formula C19H25ClN2O2S and a molecular weight of 380.94 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N-cyclohexyl-3-methyl-5-oxothiomorpholine-3-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N-cyclohexyl-3-methyl-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 12013366 |
| Molecular Formula | C19H25ClN2O2S |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N-cyclohexyl-3-methyl-5-oxothiomorpholine-3-carboxamide |
| SMILES | CC1(C(=O)NC2CCCCC2)CSCC(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H25ClN2O2S/c1-19(18(24)21-16-5-3-2-4-6-16)13-25-12-17(23)22(19)11-14-7-9-15(20)10-8-14/h7-10,16H,2-6,11-13H2,1H3,(H,21,24) |
| InChIKey | XMVVRTNJTNMVOV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |