C20H28N2O2S — CID 11111185
4-benzyl-N-cyclohexyl-3-methyl-5-oxo-1,4-thiazepane-3-carboxamide (PubChem CID 11111185) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is 4-benzyl-N-cyclohexyl-3-methyl-5-oxo-1,4-thiazepane-3-carboxamide.
| Compound Name | 4-benzyl-N-cyclohexyl-3-methyl-5-oxo-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 11111185 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 4-benzyl-N-cyclohexyl-3-methyl-5-oxo-1,4-thiazepane-3-carboxamide |
| SMILES | CC1(C(=O)NC2CCCCC2)CSCCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H28N2O2S/c1-20(19(24)21-17-10-6-3-7-11-17)15-25-13-12-18(23)22(20)14-16-8-4-2-5-9-16/h2,4-5,8-9,17H,3,6-7,10-15H2,1H3,(H,21,24) |
| InChIKey | ZDYFWYQLXRZJAC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |