C23H32N2O2S — CID 9497472
(5aR,9aS)-5-benzyl-N-cyclohexyl-4-oxo-3,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]thiazepine-5a-carboxamide (PubChem CID 9497472) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is (5aR,9aS)-5-benzyl-N-cyclohexyl-4-oxo-3,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]thiazepine-5a-carboxamide.
| Compound Name | (5aR,9aS)-5-benzyl-N-cyclohexyl-4-oxo-3,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]thiazepine-5a-carboxamide |
|---|---|
| PubChem CID | 9497472 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (5aR,9aS)-5-benzyl-N-cyclohexyl-4-oxo-3,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]thiazepine-5a-carboxamide |
| SMILES | O=C1CCS[C@H]2CCCC[C@]2(C(=O)NC2CCCCC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H32N2O2S/c26-21-14-16-28-20-13-7-8-15-23(20,22(27)24-19-11-5-2-6-12-19)25(21)17-18-9-3-1-4-10-18/h1,3-4,9-10,19-20H,2,5-8,11-17H2,(H,24,27)/t20-,23-/m0/s1 |
| InChIKey | BMAMCVKBLQNHKB-REWPJTCUSA-N |
| XLogP | 4.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |