C27H31ClN2O2S — CID 11812870
(4aS,11aS)-5-[(4-chlorophenyl)methyl]-N-cyclohexyl-6-oxo-2,3,4,11a-tetrahydro-1H-benzo[b][1,4]benzothiazepine-4a-carboxamide (PubChem CID 11812870) has the molecular formula C27H31ClN2O2S and a molecular weight of 483.08 g/mol. Its IUPAC name is (4aS,11aS)-5-[(4-chlorophenyl)methyl]-N-cyclohexyl-6-oxo-2,3,4,11a-tetrahydro-1H-benzo[b][1,4]benzothiazepine-4a-carboxamide.
| Compound Name | (4aS,11aS)-5-[(4-chlorophenyl)methyl]-N-cyclohexyl-6-oxo-2,3,4,11a-tetrahydro-1H-benzo[b][1,4]benzothiazepine-4a-carboxamide |
|---|---|
| PubChem CID | 11812870 |
| Molecular Formula | C27H31ClN2O2S |
| Molecular Weight | 483.08 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | (4aS,11aS)-5-[(4-chlorophenyl)methyl]-N-cyclohexyl-6-oxo-2,3,4,11a-tetrahydro-1H-benzo[b][1,4]benzothiazepine-4a-carboxamide |
| SMILES | O=C1c2ccccc2S[C@H]2CCCC[C@@]2(C(=O)NC2CCCCC2)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H31ClN2O2S/c28-20-15-13-19(14-16-20)18-30-25(31)22-10-4-5-11-23(22)33-24-12-6-7-17-27(24,30)26(32)29-21-8-2-1-3-9-21/h4-5,10-11,13-16,21,24H,1-3,6-9,12,17-18H2,(H,29,32)/t24-,27+/m0/s1 |
| InChIKey | UKNMNXHIRUBEDV-RPLLCQBOSA-N |
| XLogP | 6.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.08 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |