C24H22ClN3O2 — CID 124603237
(2E)-2-[1-[(4-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-2-cyano-N-cyclohexylacetamide (PubChem CID 124603237) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is (2E)-2-[1-[(4-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-2-cyano-N-cyclohexylacetamide.
| Compound Name | (2E)-2-[1-[(4-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-2-cyano-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 124603237 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2E)-2-[1-[(4-chlorophenyl)methyl]-2-oxoindol-3-ylidene]-2-cyano-N-cyclohexylacetamide |
| SMILES | N#C/C(C(=O)NC1CCCCC1)=C1\C(=O)N(Cc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C24H22ClN3O2/c25-17-12-10-16(11-13-17)15-28-21-9-5-4-8-19(21)22(24(28)30)20(14-26)23(29)27-18-6-2-1-3-7-18/h4-5,8-13,18H,1-3,6-7,15H2,(H,27,29)/b22-20+ |
| InChIKey | GTKBRFWFIJWOCA-LSDHQDQOSA-N |
| XLogP | 4.61 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|