C19H13Cl2N3O2 — CID 23969128
2-cyano-N-(2,5-dichlorophenyl)-2-(1-ethyl-2-oxoindol-3-ylidene)acetamide (PubChem CID 23969128) has the molecular formula C19H13Cl2N3O2 and a molecular weight of 386.24 g/mol. Its IUPAC name is 2-cyano-N-(2,5-dichlorophenyl)-2-(1-ethyl-2-oxoindol-3-ylidene)acetamide.
| Compound Name | 2-cyano-N-(2,5-dichlorophenyl)-2-(1-ethyl-2-oxoindol-3-ylidene)acetamide |
|---|---|
| PubChem CID | 23969128 |
| Molecular Formula | C19H13Cl2N3O2 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-cyano-N-(2,5-dichlorophenyl)-2-(1-ethyl-2-oxoindol-3-ylidene)acetamide |
| SMILES | CCN1C(=O)C(=C(C#N)C(=O)Nc2cc(Cl)ccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C19H13Cl2N3O2/c1-2-24-16-6-4-3-5-12(16)17(19(24)26)13(10-22)18(25)23-15-9-11(20)7-8-14(15)21/h3-9H,2H2,1H3,(H,23,25) |
| InChIKey | BNSPALSIZSCLMZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|