C25H26N2O5 — CID 55545613
[1-(cyclohexylamino)-1-oxopropan-2-yl] 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate (PubChem CID 55545613) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
|---|---|
| PubChem CID | 55545613 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 4-[(1,3-dioxoisoindol-2-yl)methyl]benzoate |
| SMILES | CC(OC(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C25H26N2O5/c1-16(22(28)26-19-7-3-2-4-8-19)32-25(31)18-13-11-17(12-14-18)15-27-23(29)20-9-5-6-10-21(20)24(27)30/h5-6,9-14,16,19H,2-4,7-8,15H2,1H3,(H,26,28) |
| InChIKey | MTZYUBULJTUYDV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|