C24H22BrN3O2 — CID 126119880
(2Z)-2-(1-benzyl-5-bromo-2-oxoindol-3-ylidene)-2-cyano-N-cyclohexylacetamide (PubChem CID 126119880) has the molecular formula C24H22BrN3O2 and a molecular weight of 464.36 g/mol. Its IUPAC name is (2Z)-2-(1-benzyl-5-bromo-2-oxoindol-3-ylidene)-2-cyano-N-cyclohexylacetamide.
| Compound Name | (2Z)-2-(1-benzyl-5-bromo-2-oxoindol-3-ylidene)-2-cyano-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 126119880 |
| Molecular Formula | C24H22BrN3O2 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (2Z)-2-(1-benzyl-5-bromo-2-oxoindol-3-ylidene)-2-cyano-N-cyclohexylacetamide |
| SMILES | N#C/C(C(=O)NC1CCCCC1)=C1/C(=O)N(Cc2ccccc2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C24H22BrN3O2/c25-17-11-12-21-19(13-17)22(24(30)28(21)15-16-7-3-1-4-8-16)20(14-26)23(29)27-18-9-5-2-6-10-18/h1,3-4,7-8,11-13,18H,2,5-6,9-10,15H2,(H,27,29)/b22-20- |
| InChIKey | HDUARDSVQJFLAF-XDOYNYLZSA-N |
| XLogP | 4.72 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|