C21H30N2O3S — CID 51571845
(5aS,9aS)-N-cyclohexyl-5-(furan-2-ylmethyl)-4-oxo-3,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]thiazepine-5a-carboxamide (PubChem CID 51571845) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is (5aS,9aS)-N-cyclohexyl-5-(furan-2-ylmethyl)-4-oxo-3,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]thiazepine-5a-carboxamide.
| Compound Name | (5aS,9aS)-N-cyclohexyl-5-(furan-2-ylmethyl)-4-oxo-3,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]thiazepine-5a-carboxamide |
|---|---|
| PubChem CID | 51571845 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (5aS,9aS)-N-cyclohexyl-5-(furan-2-ylmethyl)-4-oxo-3,6,7,8,9,9a-hexahydro-2H-benzo[b][1,4]thiazepine-5a-carboxamide |
| SMILES | O=C1CCS[C@H]2CCCC[C@@]2(C(=O)NC2CCCCC2)N1Cc1ccco1 |
| InChI | InChI=1S/C21H30N2O3S/c24-19-11-14-27-18-10-4-5-12-21(18,23(19)15-17-9-6-13-26-17)20(25)22-16-7-2-1-3-8-16/h6,9,13,16,18H,1-5,7-8,10-12,14-15H2,(H,22,25)/t18-,21+/m0/s1 |
| InChIKey | KSTDDNXHTUFING-GHTZIAJQSA-N |
| XLogP | 3.88 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |