C25H25N3 — CID 12014152
1,2-bis[(1R)-1-naphthalen-2-ylethyl]guanidine (PubChem CID 12014152) has the molecular formula C25H25N3 and a molecular weight of 367.50 g/mol. Its IUPAC name is 1,2-bis[(1R)-1-naphthalen-2-ylethyl]guanidine.
| Compound Name | 1,2-bis[(1R)-1-naphthalen-2-ylethyl]guanidine |
|---|---|
| PubChem CID | 12014152 |
| Molecular Formula | C25H25N3 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 1,2-bis[(1R)-1-naphthalen-2-ylethyl]guanidine |
| SMILES | C[C@@H](/N=C(\N)N[C@H](C)c1ccc2ccccc2c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H25N3/c1-17(21-13-11-19-7-3-5-9-23(19)15-21)27-25(26)28-18(2)22-14-12-20-8-4-6-10-24(20)16-22/h3-18H,1-2H3,(H3,26,27,28)/t17-,18-/m1/s1 |
| InChIKey | FYYHTHUYJLSMPO-QZTJIDSGSA-N |
| XLogP | 5.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|