C18H21N — CID 146180917
4-methyl-N-(1-naphthalen-2-ylethyl)penta-1,4-dien-2-amine (PubChem CID 146180917) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-methyl-N-(1-naphthalen-2-ylethyl)penta-1,4-dien-2-amine.
| Compound Name | 4-methyl-N-(1-naphthalen-2-ylethyl)penta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 146180917 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 4-methyl-N-(1-naphthalen-2-ylethyl)penta-1,4-dien-2-amine |
| SMILES | C=C(C)CC(=C)NC(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H21N/c1-13(2)11-14(3)19-15(4)17-10-9-16-7-5-6-8-18(16)12-17/h5-10,12,15,19H,1,3,11H2,2,4H3 |
| InChIKey | MJARHXNHFMSKRO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|