C15H15NO2S — CID 12014781
1-ethyl-4-(4-hydroxybut-2-ynylsulfanyl)quinolin-2-one (PubChem CID 12014781) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-ethyl-4-(4-hydroxybut-2-ynylsulfanyl)quinolin-2-one.
| Compound Name | 1-ethyl-4-(4-hydroxybut-2-ynylsulfanyl)quinolin-2-one |
|---|---|
| PubChem CID | 12014781 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-ethyl-4-(4-hydroxybut-2-ynylsulfanyl)quinolin-2-one |
| SMILES | CCn1c(=O)cc(SCC#CCO)c2ccccc21 |
| InChI | InChI=1S/C15H15NO2S/c1-2-16-13-8-4-3-7-12(13)14(11-15(16)18)19-10-6-5-9-17/h3-4,7-8,11,17H,2,9-10H2,1H3 |
| InChIKey | UVHJJSHSPSBICP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|