C20H27N3O3S — CID 22334549
2-(1-ethyl-2-oxoquinolin-4-yl)sulfanyl-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 22334549) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-(1-ethyl-2-oxoquinolin-4-yl)sulfanyl-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(1-ethyl-2-oxoquinolin-4-yl)sulfanyl-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 22334549 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-(1-ethyl-2-oxoquinolin-4-yl)sulfanyl-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | CCn1c(=O)cc(SCC(=O)NCCCN2CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C20H27N3O3S/c1-2-23-17-7-4-3-6-16(17)18(14-20(23)25)27-15-19(24)21-8-5-9-22-10-12-26-13-11-22/h3-4,6-7,14H,2,5,8-13,15H2,1H3,(H,21,24) |
| InChIKey | BKGSJNMBDSVOGY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|