C33H40N4O4 — CID 67596232
3-[bis(4-hydroxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]-N-(3-morpholin-4-ylpropyl)indole-2-carboxamide (PubChem CID 67596232) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is 3-[bis(4-hydroxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]-N-(3-morpholin-4-ylpropyl)indole-2-carboxamide.
| Compound Name | 3-[bis(4-hydroxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]-N-(3-morpholin-4-ylpropyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 67596232 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 3-[bis(4-hydroxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]-N-(3-morpholin-4-ylpropyl)indole-2-carboxamide |
| SMILES | CN(C)CCn1c(C(=O)NCCCN2CCOCC2)c(C(c2ccc(O)cc2)c2ccc(O)cc2)c2ccccc21 |
| InChI | InChI=1S/C33H40N4O4/c1-35(2)18-19-37-29-7-4-3-6-28(29)31(32(37)33(40)34-16-5-17-36-20-22-41-23-21-36)30(24-8-12-26(38)13-9-24)25-10-14-27(39)15-11-25/h3-4,6-15,30,38-39H,5,16-23H2,1-2H3,(H,34,40) |
| InChIKey | LLVHFMFNKHEDGU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|