C32H32N4O3 — CID 67595092
3-[bis(4-hydroxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]-N-(pyridin-3-ylmethyl)indole-2-carboxamide (PubChem CID 67595092) has the molecular formula C32H32N4O3 and a molecular weight of 520.63 g/mol. Its IUPAC name is 3-[bis(4-hydroxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]-N-(pyridin-3-ylmethyl)indole-2-carboxamide.
| Compound Name | 3-[bis(4-hydroxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]-N-(pyridin-3-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 67595092 |
| Molecular Formula | C32H32N4O3 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 3-[bis(4-hydroxyphenyl)methyl]-1-[2-(dimethylamino)ethyl]-N-(pyridin-3-ylmethyl)indole-2-carboxamide |
| SMILES | CN(C)CCn1c(C(=O)NCc2cccnc2)c(C(c2ccc(O)cc2)c2ccc(O)cc2)c2ccccc21 |
| InChI | InChI=1S/C32H32N4O3/c1-35(2)18-19-36-28-8-4-3-7-27(28)30(31(36)32(39)34-21-22-6-5-17-33-20-22)29(23-9-13-25(37)14-10-23)24-11-15-26(38)16-12-24/h3-17,20,29,37-38H,18-19,21H2,1-2H3,(H,34,39) |
| InChIKey | PDHFXQPIEYDSPS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|