C31H37N3O — CID 54210388
3-benzhydryl-1-[4-(dimethylamino)butyl]-N-propylindole-2-carboxamide (PubChem CID 54210388) has the molecular formula C31H37N3O and a molecular weight of 467.66 g/mol. Its IUPAC name is 3-benzhydryl-1-[4-(dimethylamino)butyl]-N-propylindole-2-carboxamide.
| Compound Name | 3-benzhydryl-1-[4-(dimethylamino)butyl]-N-propylindole-2-carboxamide |
|---|---|
| PubChem CID | 54210388 |
| Molecular Formula | C31H37N3O |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 3-benzhydryl-1-[4-(dimethylamino)butyl]-N-propylindole-2-carboxamide |
| SMILES | CCCNC(=O)c1c(C(c2ccccc2)c2ccccc2)c2ccccc2n1CCCCN(C)C |
| InChI | InChI=1S/C31H37N3O/c1-4-21-32-31(35)30-29(28(24-15-7-5-8-16-24)25-17-9-6-10-18-25)26-19-11-12-20-27(26)34(30)23-14-13-22-33(2)3/h5-12,15-20,28H,4,13-14,21-23H2,1-3H3,(H,32,35) |
| InChIKey | PVNXZULJOGBGAI-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|