C32H37N3O — CID 54041218
3-benzhydryl-N-cyclohexyl-1-[2-(dimethylamino)ethyl]indole-2-carboxamide (PubChem CID 54041218) has the molecular formula C32H37N3O and a molecular weight of 479.67 g/mol. Its IUPAC name is 3-benzhydryl-N-cyclohexyl-1-[2-(dimethylamino)ethyl]indole-2-carboxamide.
| Compound Name | 3-benzhydryl-N-cyclohexyl-1-[2-(dimethylamino)ethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 54041218 |
| Molecular Formula | C32H37N3O |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | 3-benzhydryl-N-cyclohexyl-1-[2-(dimethylamino)ethyl]indole-2-carboxamide |
| SMILES | CN(C)CCn1c(C(=O)NC2CCCCC2)c(C(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C32H37N3O/c1-34(2)22-23-35-28-21-13-12-20-27(28)30(31(35)32(36)33-26-18-10-5-11-19-26)29(24-14-6-3-7-15-24)25-16-8-4-9-17-25/h3-4,6-9,12-17,20-21,26,29H,5,10-11,18-19,22-23H2,1-2H3,(H,33,36) |
| InChIKey | LMMIYIGEMRKLPP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|