C30H31ClN2O3 — CID 67595583
3-[[4-(2-chloroethoxy)phenyl]-phenylmethyl]-1-(2-pyrrolidin-1-ylethyl)indole-2-carboxylic acid (PubChem CID 67595583) has the molecular formula C30H31ClN2O3 and a molecular weight of 503.04 g/mol. Its IUPAC name is 3-[[4-(2-chloroethoxy)phenyl]-phenylmethyl]-1-(2-pyrrolidin-1-ylethyl)indole-2-carboxylic acid.
| Compound Name | 3-[[4-(2-chloroethoxy)phenyl]-phenylmethyl]-1-(2-pyrrolidin-1-ylethyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 67595583 |
| Molecular Formula | C30H31ClN2O3 |
| Molecular Weight | 503.04 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 3-[[4-(2-chloroethoxy)phenyl]-phenylmethyl]-1-(2-pyrrolidin-1-ylethyl)indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(C(c2ccccc2)c2ccc(OCCCl)cc2)c2ccccc2n1CCN1CCCC1 |
| InChI | InChI=1S/C30H31ClN2O3/c31-16-21-36-24-14-12-23(13-15-24)27(22-8-2-1-3-9-22)28-25-10-4-5-11-26(25)33(29(28)30(34)35)20-19-32-17-6-7-18-32/h1-5,8-15,27H,6-7,16-21H2,(H,34,35) |
| InChIKey | XHGSSUQMYQLAMG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.04 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|